Introduction:Basic information about CAS 31431-19-3|4-Amino-3-nitrobenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Amino-3-nitrobenzophenone |
|---|
| CAS Number | 31431-19-3 | Molecular Weight | 242.230 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 449.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10N2O3 | Melting Point | 140-143 °C(lit.) |
|---|
| MSDS | / | Flash Point | 225.8±25.9 °C |
|---|
Names
| Name | 4-Amino-3-nitrobenzophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 449.7±35.0 °C at 760 mmHg |
|---|
| Melting Point | 140-143 °C(lit.) |
|---|
| Molecular Formula | C13H10N2O3 |
|---|
| Molecular Weight | 242.230 |
|---|
| Flash Point | 225.8±25.9 °C |
|---|
| Exact Mass | 242.069138 |
|---|
| PSA | 88.91000 |
|---|
| LogP | 3.42 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | NGOOFAMQPUEDJM-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(C(=O)c2ccccc2)cc1[N+](=O)[O-] |
|---|
| Water Solubility | 10 mg/L (20 ºC) |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2922399090 |
|---|
Customs
| HS Code | 2922399090 |
|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Amino-3-nitro-benzophenon |
| Methanone, (4-amino-3-nitrophenyl)phenyl- |
| 3-nitro-4-aminobenzophenone |
| 4-AMINO-3-NITROBENZOPHENONE= |
| 4-Amino-3-nitrobenzophenone |
| (4-Amino-3-nitrophenyl)(phenyl)methanone |
| 2-nitro-4-benzoylaniline |
| MFCD00007154 |
| EINECS 250-631-2 |