Introduction：Basic information about CAS 4433-79-8|N-(4-Chloro-2,5-dimethoxyphenyl)-3-oxobutanamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Chloro-2,5-dimethoxyphenyl)-3-oxobutanamide |
|---|
| CAS Number | 4433-79-8 | Molecular Weight | 271.697 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 432.7±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H14ClNO4 | Melting Point | 102-104°C |
|---|
| MSDS | / | Flash Point | 215.5±28.7 °C |
|---|
Names
| Name | 4'-Chloro-2',5'-dimethoxyacetoacetanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 432.7±45.0 °C at 760 mmHg |
|---|
| Melting Point | 102-104°C |
|---|
| Molecular Formula | C12H14ClNO4 |
|---|
| Molecular Weight | 271.697 |
|---|
| Flash Point | 215.5±28.7 °C |
|---|
| Exact Mass | 271.061127 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 2.11 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | MOUVJGIRLPZEES-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(=O)CC(C)=O)c(OC)cc1Cl |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R10:Flammable. R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S16-S26-S36-S37/39 |
|---|
| RIDADR | UN 1993 3/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Naphtol As-lgll |
| 1-acetoacetylamino-4-chloro-2,5-dimethoxy-benzene |
| 1-acetoacetylamino-2,5-dimethoxy-4-chlorobenzene |
| Azoic Coupling Component 44 |
| EINECS 224-638-6 |
| acetoacet-4-chloro-2,5-dimethoxyanilide |
| N-(4-chloro-2,5-dimethoxyphenyl)-3-oxo-butanamide |
| NAPTHOL AS-IRG |
| acetoacetyl-2,5-dimethoxy-4-chloroaniline |
| Yellow Base GC. |
| Naphtazol 4J |
| N-(4-Chloro-2,5-dimethoxyphenyl)-3-oxobutanamide |
| chinizol |
| 4'-Chloro-2',5'-diMethoxyacetoacetanilide |
| AS-IRG |
| NAPHTHOL AS-IRG |
| Naphtol AS-IRG |
| Butanamide, N-(4-chloro-2,5-dimethoxyphenyl)-3-oxo- |
| N-(4-Chloro-2,5-dimethoxyphenyl)acetoacetamide |
| MFCD00026256 |
| acetoacetamino-2,5-dimethoxy-4-chlorobenzene |
| Sanatol IRG |
