Introduction:Basic information about CAS 618-80-4|2,6-Dichloro-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Dichloro-4-nitrophenol |
|---|
| CAS Number | 618-80-4 | Molecular Weight | 207.999 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 285.2±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H3Cl2NO3 | Melting Point | 123-126 °C (dec.) |
|---|
| MSDS | / | Flash Point | 126.3±27.3 °C |
|---|
Names
| Name | 2,6-Dichloro-4-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 285.2±40.0 °C at 760 mmHg |
|---|
| Melting Point | 123-126 °C (dec.) |
|---|
| Molecular Formula | C6H3Cl2NO3 |
|---|
| Molecular Weight | 207.999 |
|---|
| Flash Point | 126.3±27.3 °C |
|---|
| Exact Mass | 206.949005 |
|---|
| PSA | 66.05000 |
|---|
| LogP | 2.88 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.639 |
|---|
| InChIKey | PXSGFTWBZNPNIC-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cc(Cl)c(O)c(Cl)c1 |
|---|
Safety Information
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S26-S36-S36/37/39 |
|---|
| RIDADR | UN 2811 6.1/PG 1 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 4.1 |
|---|
| HS Code | 2908999090 |
|---|
Customs
| HS Code | 2908999090 |
|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 2,6-Dichlor-4-nitrobenzolol |
| EINECS 210-563-6 |
| Phenol,2,6-dichloro-4-nitro |
| 2.6-Dichlor-4-nitro-1-hydroxy-benzol |
| MFCD00014715 |
| 2,6-Dichloro-4-nitrophenol |
| 2-6-Dichloro-4-nitrophenol |
| 2,6-Dichlor-4-nitro-phenol |
| 4-Nitro-2,6-dichlorophenol |
| 2,5-DIBROMO-4-METHOXYPHENYLBORONIC ACID |
| Phenol, 2,6-dichloro-4-nitro- |