Introduction：Basic information about CAS 3113-71-1|3-Methyl-4-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Methyl-4-nitrobenzoic acid |
|---|
| CAS Number | 3113-71-1 | Molecular Weight | 181.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 356.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO4 | Melting Point | 216-218 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 161.2±13.0 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3-Methyl-4-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 356.0±30.0 °C at 760 mmHg |
|---|
| Melting Point | 216-218 °C(lit.) |
|---|
| Molecular Formula | C8H7NO4 |
|---|
| Molecular Weight | 181.145 |
|---|
| Flash Point | 161.2±13.0 °C |
|---|
| Exact Mass | 181.037506 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XDTTUTIFWDAMIX-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)O)ccc1[N+](=O)[O-] |
|---|
| Water Solubility | <0.1 g/100 mL at 22 ºC |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36-S36/37/39-S22 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| m-Toluic acid,4-nitro |
| 4-nitro-3-methylbemzoic acid |
| 3-Methyl-4-nitro-benzoesaeure |
| 4-Nitro-3-methylbenzoic acid |
| 3-Methyl-4-nitrobenzoic acid |
| 4-Nitro-m-toluic acid |
| EINECS 221-479-4 |
| 3-Methyl-4-nitro benzoic acid |
| 3-Methyl-4-nitrobenzoicacid |
| 3-METHYL-4-NITROBENZENECARBOXYLIC ACID |
| Benzoic acid,3-methyl-4-nitro |
| Benzoic acid, 3-methyl-4-nitro- |
| MFCD00007168 |
