Introduction：Basic information about CAS 16494-24-9|Benzoic acid,4-[(butoxycarbonyl)oxy]-, 4-ethoxyphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,4-[(butoxycarbonyl)oxy]-, 4-ethoxyphenyl ester |
|---|
| CAS Number | 16494-24-9 | Molecular Weight | 358.38500 |
|---|
| Density | 1.167g/cm3 | Boiling Point | 495.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H22O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.2ºC |
|---|
Names
| Name | (4-ethoxyphenyl) 4-butoxycarbonyloxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.167g/cm3 |
|---|
| Boiling Point | 495.2ºC at 760mmHg |
|---|
| Molecular Formula | C20H22O6 |
|---|
| Molecular Weight | 358.38500 |
|---|
| Flash Point | 216.2ºC |
|---|
| Exact Mass | 358.14200 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 4.62000 |
|---|
| Vapour Pressure | 6.02E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | GIJIKFKGLZGENN-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(OCC)cc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | 24/25 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Butyl-p-(p-ethoxyphenoxycarbonyl)-phenyl-carbonat |
| Butyl para-(para-ethoxyphenoxycarbonyl)phenylcarbonate |
| 4-Butoxycarbonyloxy-benzoesaeure-<4-aethoxy-phenylester> |
| n-butyl-4(4'-ethoxyphenyloxycarbonyl)phenyl carbonate |
| p-<p-Aethoxy-phenoxy-carbonyl>-phenyl-butylcarbonat |
| BEPC |
| Butyl-p-(p-ethoxyphenoxycarbonyl)-phenylcarbonate |
| 4-ethoxyphenyl-4-[(butoxycarbonyl)oxy]benzoat |
| 4-Ethoxyphenyl 4-((butoxycarbonyl)oxy)benzoate |
| 4-ethoxyphenyl 4-[(butoxycarbonyl)oxy]benzoate |
| Benzoic acid,4-[(butoxycarbonyl)oxy]-,4-ethoxyphenyl ester |
| MFCD00051359 |
