Introduction:Basic information about CAS 341-02-6|Triphenylmethylium tetrafluoroborate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triphenylmethylium tetrafluoroborate |
|---|
| CAS Number | 341-02-6 | Molecular Weight | 330.127 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H15BF4 | Melting Point | 205-215 °C (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | diphenylmethylbenzene,tetrafluoroborate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 205-215 °C (dec.)(lit.) |
|---|
| Molecular Formula | C19H15BF4 |
|---|
| Molecular Weight | 330.127 |
|---|
| Exact Mass | 330.120300 |
|---|
| LogP | 6.00580 |
|---|
| InChIKey | VQXBOEYKSVVPSP-UHFFFAOYSA-N |
|---|
| SMILES | F[B-](F)(F)F.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| Tritylium Tetrafluoroborate |
| MFCD00013120 |
| Trityl tetrafluoroborate |
| [CPh3][BF4] |
| triphenylmethane tetrafluoroborate |
| EINECS 206-433-3 |
| Triphenylcarbenium Tetrafluoroborate |
| Tris(phenyl)methylium tetrafluoroborate |
| [Ph3C][BF4] |
| trityl cation |
| Ph3C(1+)BF4(1-) |
| Triphenylmethylium tetrafluoroborate |
| Triphenylmethyl fluoroborate |
| Trityl fluoroborate |