Introduction：Basic information about CAS 3112-46-7|2-Mesityl-2-oxoacetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Mesityl-2-oxoacetic acid |
|---|
| CAS Number | 3112-46-7 | Molecular Weight | 192.21100 |
|---|
| Density | 1.169g/cm3 | Boiling Point | 339.9ºC at 760mmHg |
|---|
| Molecular Formula | C11H12O3 | Melting Point | 123-124ºC |
|---|
| MSDS | USA | Flash Point | 173.5ºC |
|---|
Names
| Name | 2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.169g/cm3 |
|---|
| Boiling Point | 339.9ºC at 760mmHg |
|---|
| Melting Point | 123-124ºC |
|---|
| Molecular Formula | C11H12O3 |
|---|
| Molecular Weight | 192.21100 |
|---|
| Flash Point | 173.5ºC |
|---|
| Exact Mass | 192.07900 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 1.87910 |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | IRSQOXNQMAUSTG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c(C(=O)C(=O)O)c(C)c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| MFCD00151834 |
| mesitylglyoxylic acid |
| 2,4,6-trimethylbenzoylformic acid |
| mesiylglyoxylic acid |
| mesitoyl formic acid |
| Mesityl-glyoxylsaeure |
