Introduction：Basic information about CAS 138722-96-0|atrazine mercapturate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | atrazine mercapturate |
|---|
| CAS Number | 138722-96-0 | Molecular Weight | 342.41700 |
|---|
| Density | 1.31g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H22N6O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2R)-2-acetamido-3-[[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]sulfanyl]propanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Molecular Formula | C13H22N6O3S |
|---|
| Molecular Weight | 342.41700 |
|---|
| Exact Mass | 342.14700 |
|---|
| PSA | 154.43000 |
|---|
| LogP | 1.34200 |
|---|
| Index of Refraction | 1.581 |
|---|
| InChIKey | JYBXBVCDDNBLJW-VIFPVBQESA-N |
|---|
| SMILES | CCNc1nc(NC(C)C)nc(SCC(NC(C)=O)C(=O)O)n1 |
|---|
