Introduction:Basic information about CAS 138812-69-8|4-Phenylmethoxycarbonyl-2-piperazinecarboxylic acid hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Phenylmethoxycarbonyl-2-piperazinecarboxylic acid hydrochloride |
|---|
| CAS Number | 138812-69-8 | Molecular Weight | 264.277 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.1±28.7 °C |
|---|
Names
| Name | (S)-4-(Benzyloxycarbonyl)piperazine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 465.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H16N2O4 |
|---|
| Molecular Weight | 264.277 |
|---|
| Flash Point | 235.1±28.7 °C |
|---|
| Exact Mass | 264.110992 |
|---|
| PSA | 78.87000 |
|---|
| LogP | 0.88 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | ARLOIFJEXPDJGV-NSHDSACASA-N |
|---|
| SMILES | O=C(O)C1CN(C(=O)OCc2ccccc2)CCN1 |
|---|
Synonyms
| (2S)-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| (2S)-4-[(Benzyloxy)carbonyl]-2-piperazinecarboxylic acid |
| 1,3-Piperazinedicarboxylic acid, 1-(phenylmethyl) ester, (3S)- |