CAS 3970-35-2|2-Chloro-3-nitrobenzoic acid
Introduction：Basic information about CAS 3970-35-2|2-Chloro-3-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-nitrobenzoic acid | ||
|---|---|---|---|
| CAS Number | 3970-35-2 | Molecular Weight | 201.564 |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 359.9±27.0 °C at 760 mmHg |
| Molecular Formula | C7H4ClNO4 | Melting Point | 183-187 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 171.5±23.7 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 2-Chloro-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.9±27.0 °C at 760 mmHg |
| Melting Point | 183-187 °C(lit.) |
| Molecular Formula | C7H4ClNO4 |
| Molecular Weight | 201.564 |
| Flash Point | 171.5±23.7 °C |
| Exact Mass | 200.982880 |
| PSA | 83.12000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | JRQDVRIQJJPHEQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1Cl |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
Customs
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
Articles3
More Articles| Synthesis and cytotoxic activity of benzophenanthrolinone analogues of acronycine. Chem. Pharm. Bull. 49(9) , 1077-80, (2001) Condensation of either 2-bromobenzoic acid (4) or 2-chloro-3-nitrobenzoic acid (5) with suitable aminoquinolines 6-8 afforded phenylquinolylamines 9-13. Acid mediated cyclization gave the correspondin... | |
Synth. Commun. 36 , 1715, (2006) | |
| Design and synthesis of new biprivileged molecular scaffolds: indolo-fused benzodiazepinyl/quinoxalinyl benzimidazoles. Chem. Asian J. 7(7) , 1684-90, (2012) The present article describes the design and synthesis of new biprivileged molecular scaffolds with diverse structural features. Commercially available, simple heterocyclic building blocks such as 4-f... |
Synonyms
| 2-chloro-nitrobenzoic acid |
| MFCD00007069 |
| 2-chloro-3-nitrobezoic acid |
| WNR BG CVQ |
| 2-chloro-3-carboxy-nitrobenzene |
| 2-chloro-3-nitrobenzoicacid |
| Benzoic acid, 2-chloro-3-nitro- |
| chloro-nitrobenzoic acid |
| 2-Chloro-3-nitrobenzoic acid |
| 3-Nitro-2-chlorobenzoic acid |
| EINECS 223-590-3 |
| 2-Chloro-3-nitro benzoicacid |
