Introduction：Basic information about CAS 1678-17-7|1,3,5-Pentanetrione,1-(4-methoxyphenyl)-5-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,5-Pentanetrione,1-(4-methoxyphenyl)-5-phenyl- |
|---|
| CAS Number | 1678-17-7 | Molecular Weight | 296.31700 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 475.1ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 210.9ºC |
|---|
Names
| Name | 1-(4-methoxyphenyl)-5-phenylpentane-1,3,5-trione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 475.1ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 |
|---|
| Molecular Weight | 296.31700 |
|---|
| Flash Point | 210.9ºC |
|---|
| Exact Mass | 296.10500 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 3.11010 |
|---|
| Vapour Pressure | 3.41E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | LNAFUYNMMGWAEX-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)CC(=O)CC(=O)c2ccccc2)cc1 |
|---|
Synonyms
| 1-(p-Methoxyphenyl)-5-phenyl-pentantrion-(1,3,5) |
| 1-Phenyl-5-(4-methoxy-phenyl)-1,3,5-pentantrion |
| 1-(4-Methoxy-phenyl)-5-phenyl-penten-1,3,5-trion |
| 1-(4-Methoxyphenyl)-5-phenyl-1,3,5-pentanetrione |
| 5-Phenyl-1-(4-methoxy-phenyl)-pentantrion-(1,3,5) |
