Introduction：Basic information about CAS 3115-39-7|Phosphoric acid,dioctyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Phosphoric acid,dioctyl ester |
|---|
| CAS Number | 3115-39-7 | Molecular Weight | 322.42000 |
|---|
| Density | 0.985g/cm3 | Boiling Point | 402ºC at 760mmHg |
|---|
| Molecular Formula | C16H35O4P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.9ºC |
|---|
Names
| Name | Octyl phosphate, (C8H17O)2(HO)PO |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.985g/cm3 |
|---|
| Boiling Point | 402ºC at 760mmHg |
|---|
| Molecular Formula | C16H35O4P |
|---|
| Molecular Weight | 322.42000 |
|---|
| Flash Point | 196.9ºC |
|---|
| Exact Mass | 322.22700 |
|---|
| PSA | 65.57000 |
|---|
| LogP | 5.84100 |
|---|
| InChIKey | HTDKEJXHILZNPP-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCOP(=O)(O)OCCCCCCCC |
|---|
Safety Information
Customs
| HS Code | 2919900090 |
|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| O,O-di-n-octylphosphoric acid |
| Phosphorsaeure-dioctylester |
| Einecs 221-485-7 |
| Dioctyl-hydrogenphosphat |
| phosphoric acid dioctyl ester |
| Phosphoric acid hydrogen dioctyl ester |
| dioctyl hydrogen phosphate |
| di-n-octyl phosphoric acid |
| Dioctylorthophosphate |
