Introduction：Basic information about CAS 3147-53-3|2-hydroxy-5-phenyl diazenyl benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-hydroxy-5-phenyl diazenyl benzoic acid |
|---|
| CAS Number | 3147-53-3 | Molecular Weight | 242.230 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 472.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.7±27.3 °C |
|---|
Names
| Name | 6-oxo-3-(phenylhydrazinylidene)cyclohexa-1,4-diene-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 472.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H10N2O3 |
|---|
| Molecular Weight | 242.230 |
|---|
| Flash Point | 239.7±27.3 °C |
|---|
| Exact Mass | 242.069138 |
|---|
| PSA | 82.25000 |
|---|
| LogP | 3.88 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | JHDYSXXPQIFFJZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(N=Nc2ccccc2)ccc1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2927000090 |
|---|
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 2-hydroxy-5-phenylazo-benzoic acid |
| 2-Hydroxy-5-(phenyldiazenyl)benzoic acid |
| 2-hydroxy-5-phenyldiazenyl benzoic acid |
| CK 46A |
| 2-Hydroxy-5-[(E)-phenyldiazenyl]benzoic acid |
| 4-hydroxyazobenzene-3-carboxylic acid |
| Benzoic acid, 2-hydroxy-5- (phenylazo)- |
| 5-(phenylazo)salicylic acid |
| Phenylazosalicylic Acid |
| Benzoic acid, 2-hydroxy-5-[(E)-2-phenyldiazenyl]- |
| Salicylic acid, 5- (phenylazo)- |
| 2-Hydroxy-5-phenylazo-benzoesaeure |
| 2-hydroxy-5-phenyl diazenyl benzoic acid |
