Introduction：Basic information about CAS 3139-06-8|Benzene,1-methoxy-2,5-dimethyl-4-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1-methoxy-2,5-dimethyl-4-nitro- |
|---|
| CAS Number | 3139-06-8 | Molecular Weight | 181.18900 |
|---|
| Density | 1.148g/cm3 | Boiling Point | 296.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.6ºC |
|---|
Names
| Name | 1-methoxy-2,5-dimethyl-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.148g/cm3 |
|---|
| Boiling Point | 296.6ºC at 760 mmHg |
|---|
| Molecular Formula | C9H11NO3 |
|---|
| Molecular Weight | 181.18900 |
|---|
| Flash Point | 136.6ºC |
|---|
| Exact Mass | 181.07400 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 2.74340 |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | KCPIVGRYBOMWHH-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C)c([N+](=O)[O-])cc1C |
|---|
Synonyms
| 2,5-Dimethyl-4-nitroanisol |
| 4-Nitro-2,5-dimethyl-anisol |
| 2,5-dimethyl-4-nitroanisole |
| 2-methoxy-5-nitro-1,4-dimethylbenzene |
