Introduction：Basic information about CAS 13722-96-8|2,4-Dihydroxy-5-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-Dihydroxy-5-nitrobenzoic acid |
|---|
| CAS Number | 13722-96-8 | Molecular Weight | 199.118 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 474.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 216.6±13.0 °C |
|---|
Names
| Name | 2,4-Dihydroxy-5-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 474.0±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5NO6 |
|---|
| Molecular Weight | 199.118 |
|---|
| Flash Point | 216.6±13.0 °C |
|---|
| Exact Mass | 199.011688 |
|---|
| PSA | 123.58000 |
|---|
| LogP | 2.38 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | DVHFWKCHUQZGSF-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(O)cc1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Benzoic acid,2,4-dihydroxy-5-nitro |
| 4-Nitro-6-carboxy-resorcin |
| Benzoic acid, 2,4-dihydroxy-5-nitro- |
| 2,4-Dihydroxy-5-nitro-benzoesaeure |
| 5-Nitro-2,4-dihydroxy-benzoesaeure |
| 2,4-Dihydroxy-5-nitrobenzoic acid |
| 2,4-dihydroxy-5-nitro-benzoic acid |
