Introduction：Basic information about CAS 161596-47-0|(S)-N-Glycidylphthalimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-N-Glycidylphthalimide |
|---|
| CAS Number | 161596-47-0 | Molecular Weight | 203.194 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 347.4±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | 102ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 163.9±20.4 °C |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | (s)-(+)-glycidyl phthalimide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 347.4±15.0 °C at 760 mmHg |
|---|
| Melting Point | 102ºC |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.194 |
|---|
| Flash Point | 163.9±20.4 °C |
|---|
| Exact Mass | 203.058243 |
|---|
| PSA | 49.91000 |
|---|
| LogP | 1.60 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | DUILGEYLVHGSEE-ZETCQYMHSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1CC1CO1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R41 |
|---|
| Safety Phrases | 26-39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| (S)-N-(2,3-Epoxypropyl)phthalimide |
| (S)-(+)-N-(2,3-Epoxypropyl)phthalimide |
| 1H-Isoindole-1,3(2H)-dione, 2-[(2S)-oxiranylmethyl]- |
| 2-[(2S)-oxiran-2ylmethyl]-1H-isoindole-1,3(2H)-dione |
| 2-[(2S)-Oxiran-2-ylmethyl]-1H-isoindole-1,3(2H)-dione |
| (S)-N-Glycidylphthalimide |
| (S)-2-(Oxiran-2-ylmethyl)isoindoline-1,3-dione |
| 2-[[(2S)-oxiran-2-yl]methyl]isoindole-1,3-dione |
| MFCD04973350 |
| 2-[(2S)-2-Oxiranylmethyl]-1H-isoindole-1,3(2H)-dione |
| (S)-(+)-Glycidyl Phthalimide |
| Rivaroxaban Impurity 8 |
