Introduction：Basic information about CAS 16499-52-8|2-Nitro-5-(trifluoromethyl)benzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Nitro-5-(trifluoromethyl)benzonitrile |
|---|
| CAS Number | 16499-52-8 | Molecular Weight | 216.117 |
|---|
| Density | 1.49 | Boiling Point | 304 ºC |
|---|
| Molecular Formula | C8H3F3N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 138 ºC |
|---|
Names
| Name | 2-Nitro-5-(trifluoromethyl)benzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49 |
|---|
| Boiling Point | 304 ºC |
|---|
| Molecular Formula | C8H3F3N2O2 |
|---|
| Molecular Weight | 216.117 |
|---|
| Flash Point | 138 ºC |
|---|
| Exact Mass | 216.014664 |
|---|
| PSA | 69.61000 |
|---|
| LogP | 2.27 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.499 |
|---|
| InChIKey | FHFVTHPGDCWXTD-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cc(C(F)(F)F)ccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-Cyano-4-nitrobenzotrifluoride |
| 2-Nitro-5-(trifluoromethyl)benzonitrile |
| 2-Nitro-5-trifluormethyl-benzonitril |
| PC3155 |
| Benzonitrile, 2-nitro-5-(trifluoromethyl)- |
| CL9047 |
