Introduction：Basic information about CAS 165662-68-0|3-Benzyloxy-4-Methylbenzoic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Benzyloxy-4-Methylbenzoic Acid |
|---|
| CAS Number | 165662-68-0 | Molecular Weight | 242.27000 |
|---|
| Density | 1.193g/cm3 | Boiling Point | 422.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 160ºC |
|---|
Names
| Name | 4-methyl-3-phenylmethoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.193g/cm3 |
|---|
| Boiling Point | 422.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O3 |
|---|
| Molecular Weight | 242.27000 |
|---|
| Flash Point | 160ºC |
|---|
| Exact Mass | 242.09400 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.27220 |
|---|
| Vapour Pressure | 7.02E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | ABDMYEWDLHJGIL-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(=O)O)cc1OCc1ccccc1 |
|---|
Synonyms
| 3-benzyloxy-4-methylbenzoic acid |
| 4-methyl-3-phenylmethoxy-benzoic acid |
