Introduction：Basic information about CAS 16697-49-7|3,4,6-Tri-O-benzyl-beta-D-mannopyranose-1,2-(methyl orthoacetate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,6-Tri-O-benzyl-beta-D-mannopyranose-1,2-(methyl orthoacetate) |
|---|
| CAS Number | 16697-49-7 | Molecular Weight | 506.587 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 601.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H34O7 | Melting Point | 74-76ºC |
|---|
| MSDS | / | Flash Point | 232.1±31.4 °C |
|---|
Names
| Name | 3,4,6-Tri-O-benzyl-b-D-mannopyranose 1,2-(methyl orthoacetate) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 601.1±55.0 °C at 760 mmHg |
|---|
| Melting Point | 74-76ºC |
|---|
| Molecular Formula | C30H34O7 |
|---|
| Molecular Weight | 506.587 |
|---|
| Flash Point | 232.1±31.4 °C |
|---|
| Exact Mass | 506.230438 |
|---|
| PSA | 64.61000 |
|---|
| LogP | 8.44 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.593 |
|---|
| InChIKey | SCDVHQXHQOSKCS-LGPOITBMSA-N |
|---|
| SMILES | COC1(C)OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2O1 |
|---|
| Storage condition | Refrigerator |
|---|
Synonyms
| 2,5-anhydro-3,4,6-tri-O-benzoyl-D-allonthioamide |
| 3,4,6-Tri-O-benzyl-1,2-O-(1-methoxyethylidene)-β-D-mannopyranose |
| tri-O-benzoyl-D-2,5-anhydro-allonothioic acid amide |
| β-D-Mannopyranose, 1,2-O-(1-methoxyethylidene)-3,4,6-tris-O-(phenylmethyl)- |
