Introduction：Basic information about CAS 364793-98-6|N-(4-Chloro-3-cyano-6-ethoxy-7-quinolinyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-Chloro-3-cyano-6-ethoxy-7-quinolinyl)acetamide |
|---|
| CAS Number | 364793-98-6 | Molecular Weight | 289.71700 |
|---|
| Density | 1.356g/cm3 | Boiling Point | 518.642ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12ClN3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 267.465ºC |
|---|
Names
| Name | N-(4-Chloro-3-cyano-6-ethoxy-7-quinolinyl)acetamide |
|---|
Chemical & Physical Properties
| Density | 1.356g/cm3 |
|---|
| Boiling Point | 518.642ºC at 760 mmHg |
|---|
| Molecular Formula | C14H12ClN3O2 |
|---|
| Molecular Weight | 289.71700 |
|---|
| Flash Point | 267.465ºC |
|---|
| Exact Mass | 289.06200 |
|---|
| PSA | 78.50000 |
|---|
| LogP | 3.76648 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | XSMNMLAOFZFANL-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc2c(Cl)c(C#N)cnc2cc1NC(C)=O |
|---|
