Introduction：Basic information about CAS 440101-18-8|N-(5-isopropenyl-2-pyridyl)-2-methyl-propane-1,2-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(5-isopropenyl-2-pyridyl)-2-methyl-propane-1,2-diamine |
|---|
| CAS Number | 440101-18-8 | Molecular Weight | 205.29900 |
|---|
| Density | 1.02g/cm3 | Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 163.8ºC |
|---|
Names
| Name | N-(5-isopropenyl-2-pyridyl)-2-methyl-propane-1,2-diamine |
|---|
Chemical & Physical Properties
| Density | 1.02g/cm3 |
|---|
| Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N3 |
|---|
| Molecular Weight | 205.29900 |
|---|
| Flash Point | 163.8ºC |
|---|
| Exact Mass | 205.15800 |
|---|
| PSA | 50.94000 |
|---|
| LogP | 3.03720 |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | YINOKWXFYVFXNL-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)c1ccc(NCC(C)(C)N)nc1 |
|---|
