Introduction：Basic information about CAS 440102-50-1|6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxamide |
|---|
| CAS Number | 440102-50-1 | Molecular Weight | 208.26000 |
|---|
| Density | 1.196g/cm3 | Boiling Point | 425.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H16N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211ºC |
|---|
Names
| Name | 6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxamide |
|---|
Chemical & Physical Properties
| Density | 1.196g/cm3 |
|---|
| Boiling Point | 425.2ºC at 760 mmHg |
|---|
| Molecular Formula | C10H16N4O |
|---|
| Molecular Weight | 208.26000 |
|---|
| Flash Point | 211ºC |
|---|
| Exact Mass | 208.13200 |
|---|
| PSA | 95.02000 |
|---|
| LogP | 1.98720 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | LSAKGQDJIKTJOH-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(N)CNc1ccc(C(N)=O)cn1 |
|---|
