Introduction：Basic information about CAS 440102-57-8|2-methyl-N-(4-phenylthiazol-2-yl)propane-1,2-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-methyl-N-(4-phenylthiazol-2-yl)propane-1,2-diamine |
|---|
| CAS Number | 440102-57-8 | Molecular Weight | 247.35900 |
|---|
| Density | 1.177g/cm3 | Boiling Point | 402.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 197.5ºC |
|---|
Names
| Name | 2-methyl-N-(4-phenylthiazol-2-yl)propane-1,2-diamine |
|---|
Chemical & Physical Properties
| Density | 1.177g/cm3 |
|---|
| Boiling Point | 402.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17N3S |
|---|
| Molecular Weight | 247.35900 |
|---|
| Flash Point | 197.5ºC |
|---|
| Exact Mass | 247.11400 |
|---|
| PSA | 82.41000 |
|---|
| LogP | 3.08150 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | OSUJZDKKCRSOQS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(N)CNc1nc(-c2ccccc2)cs1 |
|---|
