Introduction：Basic information about CAS 440102-67-0|methyl 6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxylate |
|---|
| CAS Number | 440102-67-0 | Molecular Weight | 223.27200 |
|---|
| Density | 1.155g/cm3 | Boiling Point | 367.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H17N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176ºC |
|---|
Names
| Name | methyl 6-[(2-amino-2-methyl-propyl)amino]pyridine-3-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.155g/cm3 |
|---|
| Boiling Point | 367.4ºC at 760 mmHg |
|---|
| Molecular Formula | C11H17N3O2 |
|---|
| Molecular Weight | 223.27200 |
|---|
| Flash Point | 176ºC |
|---|
| Exact Mass | 223.13200 |
|---|
| PSA | 77.24000 |
|---|
| LogP | 1.79070 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | NZWILCCSYGPYRH-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(NCC(C)(C)N)nc1 |
|---|
