Introduction：Basic information about CAS 440102-69-2|N-(5-isopropyl-2-pyridyl)-2-methyl-propane-1,2-diamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(5-isopropyl-2-pyridyl)-2-methyl-propane-1,2-diamine |
|---|
| CAS Number | 440102-69-2 | Molecular Weight | 207.31500 |
|---|
| Density | 1.009g/cm3 | Boiling Point | 343.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H21N3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.5ºC |
|---|
Names
| Name | N-(5-isopropyl-2-pyridyl)-2-methyl-propane-1,2-diamine |
|---|
Chemical & Physical Properties
| Density | 1.009g/cm3 |
|---|
| Boiling Point | 343.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H21N3 |
|---|
| Molecular Weight | 207.31500 |
|---|
| Flash Point | 161.5ºC |
|---|
| Exact Mass | 207.17400 |
|---|
| PSA | 50.94000 |
|---|
| LogP | 3.12750 |
|---|
| Index of Refraction | 1.55 |
|---|
| InChIKey | VZJUQXRRBAITRB-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)c1ccc(NCC(C)(C)N)nc1 |
|---|
