Introduction：Basic information about CAS 133366-27-5|7-Benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one |
|---|
| CAS Number | 133366-27-5 | Molecular Weight | 231.29000 |
|---|
| Density | 1.19g/cm3 | Boiling Point | 391.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.8ºC |
|---|
Names
| Name | 7-Benzyl-1-oxa-7-azaspiro[4.4]nonan-2-one |
|---|
Chemical & Physical Properties
| Density | 1.19g/cm3 |
|---|
| Boiling Point | 391.5ºC at 760 mmHg |
|---|
| Molecular Formula | C14H17NO2 |
|---|
| Molecular Weight | 231.29000 |
|---|
| Flash Point | 154.8ºC |
|---|
| Exact Mass | 231.12600 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 1.90600 |
|---|
| Vapour Pressure | 2.46E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | VQMBNJQWFUEDAX-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCC2(CCN(Cc3ccccc3)C2)O1 |
|---|
