Introduction：Basic information about CAS 166827-53-8|(E,E)-4,4'-Bis[2-(4-methoxyphenyl)ethenyl]-2,2'-bipyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E,E)-4,4'-Bis[2-(4-methoxyphenyl)ethenyl]-2,2'-bipyridine |
|---|
| CAS Number | 166827-53-8 | Molecular Weight | 420.50200 |
|---|
| Density | 1.182 | Boiling Point | 642.8ºC at 760 mmHg |
|---|
| Molecular Formula | C28H24N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 220.4ºC |
|---|
Names
| Name | 4-[2-(4-methoxyphenyl)ethenyl]-2-[4-[2-(4-methoxyphenyl)ethenyl]pyridin-2-yl]pyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.182 |
|---|
| Boiling Point | 642.8ºC at 760 mmHg |
|---|
| Molecular Formula | C28H24N2O2 |
|---|
| Molecular Weight | 420.50200 |
|---|
| Flash Point | 220.4ºC |
|---|
| Exact Mass | 420.18400 |
|---|
| PSA | 44.24000 |
|---|
| LogP | 6.50160 |
|---|
| Index of Refraction | 1.685 |
|---|
| InChIKey | QLYURKQGQHATLH-GGWOSOGESA-N |
|---|
| SMILES | COc1ccc(C=Cc2ccnc(-c3cc(C=Cc4ccc(OC)cc4)ccn3)c2)cc1 |
|---|
Synonyms
| 2,2'-Bipyridine,4,4'-bis[2-(4-methoxyphenyl)ethenyl]-,(E,E) |
| (E,E)-4,4'-BIS[2-(4-METHOXYPHENYL)ETHENYL]-2,2'-BIPYRIDINE |
