Introduction:Basic information about CAS 6156-37-2|4-(Diphenylamino)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Diphenylamino)benzoic acid |
|---|
| CAS Number | 6156-37-2 | Molecular Weight | 289.328 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 473.8±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.3±24.0 °C |
|---|
Names
| Name | 4-(N-phenylanilino)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 473.8±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H15NO2 |
|---|
| Molecular Weight | 289.328 |
|---|
| Flash Point | 240.3±24.0 °C |
|---|
| Exact Mass | 289.110291 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 5.72 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | XUDQSFMBCQRHAX-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
|---|
Synonyms
| N,N-diphenyl-4-aminobenzoic acid |
| 4-(diphenylamine)benzoic acid |
| 4-(Diphenylamino)benzoic acid |
| 4-Diphenylamino-benzoic acid |
| Benzoic acid, 4-(diphenylamino)- |
| 4-Diphenylamino-benzoesaeure |
| 4-(N,N-diphenylamino)benzoic acid |