Introduction：Basic information about CAS 393781-59-4|(3R)-1-benzyl-3-methyl-4-[(2-methylpropan-2-yl)oxy]-6-(oxomethylidene)piperazine-2,5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R)-1-benzyl-3-methyl-4-[(2-methylpropan-2-yl)oxy]-6-(oxomethylidene)piperazine-2,5-dione |
|---|
| CAS Number | 393781-59-4 | Molecular Weight | 318.36800 |
|---|
| Density | 1.192g/cm3 | Boiling Point | 525.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 271.5ºC |
|---|
Names
| Name | (3R)-1-benzyl-3-methyl-4-[(2-methylpropan-2-yl)oxy]-6-(oxomethylidene)piperazine-2,5-dione |
|---|
Chemical & Physical Properties
| Density | 1.192g/cm3 |
|---|
| Boiling Point | 525.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H22N2O4 |
|---|
| Molecular Weight | 318.36800 |
|---|
| Flash Point | 271.5ºC |
|---|
| Exact Mass | 318.15800 |
|---|
| PSA | 66.92000 |
|---|
| LogP | 2.05680 |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | BCCRARRUOKBIDB-GFCCVEGCSA-N |
|---|
| SMILES | CC1C(=O)N(Cc2ccccc2)C(=C=O)C(=O)N1OC(C)(C)C |
|---|
