Introduction：Basic information about CAS 160514-13-6|(2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methanol |
|---|
| CAS Number | 160514-13-6 | Molecular Weight | 252.271 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 527.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.9±32.9 °C |
|---|
Names
| Name | 2'-[(1H-Tetrazol-5-yl)biphenyl-4-yl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 527.6±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N4O |
|---|
| Molecular Weight | 252.271 |
|---|
| Flash Point | 272.9±32.9 °C |
|---|
| Exact Mass | 252.101105 |
|---|
| PSA | 74.69000 |
|---|
| LogP | 1.92 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | ZRQJTHPAIULYJV-UHFFFAOYSA-N |
|---|
| SMILES | OCc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
|---|
Synonyms
| [4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methanol |
| (2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methanol |
| [1,1'-Biphenyl]-4-methanol, 2'-(2H-tetrazol-5-yl)- |
| [2'-(2H-Tetrazol-5-yl)-4-biphenylyl]methanol |
