Introduction：Basic information about CAS 132463-02-6|Diethyl N-[5-[N-[(3,4-dihydro-2-methyl-4-oxo-6-quinazolinyl)methyl]-N-methylamino]-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diethyl N-[5-[N-[(3,4-dihydro-2-methyl-4-oxo-6-quinazolinyl)methyl]-N-methylamino]-2-thenoyl]-L-glutamate |
|---|
| CAS Number | 132463-02-6 | Molecular Weight | 514.59400 |
|---|
| Density | 1.32 | Boiling Point | / |
|---|
| Molecular Formula | C25H30N4O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Diethyl N-[5-[N-[(3,4-dihydro-2-methyl-4-oxo-6-quinazolinyl)methyl]-N-methylamino]-2-thenoyl]-L-glutamate |
|---|
Chemical & Physical Properties
| Density | 1.32 |
|---|
| Molecular Formula | C25H30N4O6S |
|---|
| Molecular Weight | 514.59400 |
|---|
| Exact Mass | 514.18900 |
|---|
| PSA | 158.93000 |
|---|
| LogP | 3.32510 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | MMEWNGFFTNKUFD-IBGZPJMESA-N |
|---|
| SMILES | CCOC(=O)CCC(NC(=O)c1ccc(N(C)Cc2ccc3nc(C)[nH]c(=O)c3c2)s1)C(=O)OCC |
|---|
