Introduction:Basic information about CAS 13122-18-4|tert-Butyl peroxy-3,5,5-trimethylhexanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl peroxy-3,5,5-trimethylhexanoate |
|---|
| CAS Number | 13122-18-4 | Molecular Weight | 230.34400 |
|---|
| Density | 0.897 | Boiling Point | 258.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H26O3 | Melting Point | -30 °C |
|---|
| MSDS | / | Flash Point | 70.8ºC |
|---|
Names
| Name | tert-Butyl peroxy-3,5,5-trimethylhexanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.897 |
|---|
| Boiling Point | 258.6ºC at 760 mmHg |
|---|
| Melting Point | -30 °C |
|---|
| Molecular Formula | C13H26O3 |
|---|
| Molecular Weight | 230.34400 |
|---|
| Flash Point | 70.8ºC |
|---|
| Exact Mass | 230.18800 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.72210 |
|---|
| Index of Refraction | 1.4295-1.4315 |
|---|
| InChIKey | VSJBBIJIXZVVLQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(CC(=O)OOC(C)(C)C)CC(C)(C)C |
|---|
| Storage condition | Refrigerator (+4°C) |
|---|
| Water Solubility | PARTLY MISCIBLE |
|---|
Safety Information
| Hazard Codes | O: Oxidizing agent;Xi: Irritant; |
|---|
| Risk Phrases | R38;R7 |
|---|
| Safety Phrases | 36/37/39-3/7-26-14A |
|---|
| RIDADR | UN 2104 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | EU1180000 |
|---|
| Hazard Class | 5.2 |
|---|
Synonyms
| EINECS 236-050-7 |
| t-butyl 3,3,5-trimethylperoxyhexanoate |
| 42s |
| Perbutyl 355 |
| tert-Butylperisononanoate |
| trigonox 42s |
| tert-butyl 3,5,5-trimethylperoxyhexanoate |
| t-Butyl peroxy-3,5,5-trimethyl hexanoate |
| Trigonox 42 |