Introduction：Basic information about CAS 253168-94-4|1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl) ethanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl) ethanamine |
|---|
| CAS Number | 253168-94-4 | Molecular Weight | 273.349 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 469.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4S | Melting Point | 120 °C |
|---|
| MSDS | / | Flash Point | 237.8±28.7 °C |
|---|
Names
| Name | 2-(3-ethoxy-4-methoxyphenyl)-1-(methylsulfonyl)eth-2-ylamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 469.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | 120 °C |
|---|
| Molecular Formula | C12H19NO4S |
|---|
| Molecular Weight | 273.349 |
|---|
| Flash Point | 237.8±28.7 °C |
|---|
| Exact Mass | 273.103485 |
|---|
| PSA | 87.00000 |
|---|
| LogP | 0.65 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | BXUJVINGXQGNFD-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc(C(N)CS(C)(=O)=O)ccc1OC |
|---|
Safety Information
Customs
| HS Code | 2922299090 |
|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 1-(3-ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethylamine |
| Benzenemethanamine, 3-ethoxy-4-methoxy-a-[(methylsulfonyl)methyl]- |
| 1-(3-Ethoxy-4-methoxy-phenyl)-2-methanesulfonyl-ethylamine |
| 1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethanamine |
| 1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethylamine |
| ApreMilast interMediate |
| 2-(3-ethoxy-4-methoxyphenyl-1-methylsulphonyl)-eth-2-ylamine |
| Apremilast Intermediate I |
| 3-Ethoxy-4-methoxy-alpha-[(methylsulfonyl)methyl]-benzenemethanamine |
| Benzenemethanamine, 3-ethoxy-4-methoxy-α-[(methylsulfonyl)methyl]- |
| 2-(3-ethoxy-4-methoxyphenyl)-1-(methanesulfonyl)-eth-2-ylamine |
| 2-(3-ethoxy-4-methoxyphenyl)-1-(methylsulphonyl)-eth-2-ylamine |
