Introduction：Basic information about CAS 137945-48-3|Lenabasum, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lenabasum |
|---|
| CAS Number | 137945-48-3 | Molecular Weight | 400.55100 |
|---|
| Density | 1.085g/cm3 | Boiling Point | 495.7ºC at 760mmHg |
|---|
| Molecular Formula | C25H36O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 158.5ºC |
|---|
Names
| Name | (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromene-9-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.085g/cm3 |
|---|
| Boiling Point | 495.7ºC at 760mmHg |
|---|
| Molecular Formula | C25H36O4 |
|---|
| Molecular Weight | 400.55100 |
|---|
| Flash Point | 158.5ºC |
|---|
| Exact Mass | 400.26100 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 6.31580 |
|---|
| Vapour Pressure | 1.2E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.535 |
|---|
| InChIKey | YCHYFHOSGQABSW-RTBURBONSA-N |
|---|
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CC=C(C(=O)O)CC21 |
|---|
Synonyms
| DMH-THC-11-OIC |
| CPL-7075 |
| IP-751 |
| Ajulemic acid |
| CT-3 |
