Introduction:Basic information about CAS 166773-08-6|1,3,4-Triphenyl-4,5-dihydro-1H-1,2,4-triazol-5-ylidene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,4-Triphenyl-4,5-dihydro-1H-1,2,4-triazol-5-ylidene |
|---|
| CAS Number | 166773-08-6 | Molecular Weight | 297.35300 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 432ºC at 760mmHg |
|---|
| Molecular Formula | C20H15N3 | Melting Point | 150ºC |
|---|
| MSDS | / | Flash Point | 215.1ºC |
|---|
Names
| Name | 2,4,5-triphenyl-3H-1,2,4-triazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 432ºC at 760mmHg |
|---|
| Melting Point | 150ºC |
|---|
| Molecular Formula | C20H15N3 |
|---|
| Molecular Weight | 297.35300 |
|---|
| Flash Point | 215.1ºC |
|---|
| Exact Mass | 297.12700 |
|---|
| PSA | 18.84000 |
|---|
| LogP | 3.65050 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | QZHWOLKBXYORRO-UHFFFAOYSA-N |
|---|
| SMILES | [c-]1n(-c2ccccc2)c(-c2ccccc2)n[n+]1-c1ccccc1 |
|---|
Safety Information
Synonyms
| 1,3,4-triphenyl-4,5-dihydro-1H-1,2,4-triazol-5-ylidene |
| 1,3,4-triphenyl-4H-1,2,4-triazol-1-ium-5-ide |
| MFCD00801868 |
| 1,3,4-triphenyl-4,5-dihydro-1,2,4-1H-triazol-5-ylidene |
| 1,3,4-triphenyl-4,5-dihydro-1H-1,2,4-triazolin-5-ylidene |
| 1,2,4-triphenyl-1,3,4-triazole-5-ylidene |