Introduction：Basic information about CAS 25379-26-4|2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoic acid |
|---|
| CAS Number | 25379-26-4 | Molecular Weight | 284.35000 |
|---|
| Density | 1.183g/cm3 | Boiling Point | 464.2ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.1ºC |
|---|
Names
| Name | 2-(naphthalen-1-ylmethyl)-3-(oxolan-2-yl)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.183g/cm3 |
|---|
| Boiling Point | 464.2ºC at 760 mmHg |
|---|
| Molecular Formula | C18H20O3 |
|---|
| Molecular Weight | 284.35000 |
|---|
| Flash Point | 169.1ºC |
|---|
| Exact Mass | 284.14100 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.65220 |
|---|
| Vapour Pressure | 2.04E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | VEJYFDMNWGFBCT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(Cc1cccc2ccccc12)CC1CCCO1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 3-(1-naphthyl)-2-(tetrahydrofuran-2-ylmethyl)propanoic acid |
| Naphthidrofurylic acid |
| 1-(tetrahydro-2-furyl)-3-(1-naphthyl)propane-2-carboxylic acid |
| 3-naphthalen-1-yl-2-tetrahydrofurfuryl-propionic acid |
| acide 2-<(naphth-1-yl)methyl>-3-(tetrahydrofur-2-yl)propanoique |
| opt.-inakt. 3-<Naphthyl-(1)>-2-tetrahydrofurfuryl-propionsaeure |
| EINECS 246-926-0 |
