Introduction：Basic information about CAS 25217-77-0|5-BROMO-3-(2-NITROVINYL)INDOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-BROMO-3-(2-NITROVINYL)INDOLE |
|---|
| CAS Number | 25217-77-0 | Molecular Weight | 267.07900 |
|---|
| Density | 1.719g/cm3 | Boiling Point | 457.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7BrN2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.3ºC |
|---|
Names
| Name | 5-bromo-3-(2-nitroethenyl)-1H-indole |
|---|
Chemical & Physical Properties
| Density | 1.719g/cm3 |
|---|
| Boiling Point | 457.1ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7BrN2O2 |
|---|
| Molecular Weight | 267.07900 |
|---|
| Flash Point | 230.3ºC |
|---|
| Exact Mass | 265.96900 |
|---|
| PSA | 61.61000 |
|---|
| LogP | 3.70100 |
|---|
| Vapour Pressure | 4.16E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.753 |
|---|
| InChIKey | QZIAWMREHPRQEK-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])C=Cc1c[nH]c2ccc(Br)cc12 |
|---|
