Introduction:Basic information about CAS 13162-26-0|2,4-dichlor-6-methyl-5-nitropyrimidin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-dichlor-6-methyl-5-nitropyrimidin |
|---|
| CAS Number | 13162-26-0 | Molecular Weight | 208.002 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 311.8±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C5H3Cl2N3O2 | Melting Point | 52-54°C |
|---|
| MSDS | USA | Flash Point | 142.4±26.5 °C |
|---|
Names
| Name | 2,4-Dichloro-6-methyl-5-nitropyrimidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 311.8±37.0 °C at 760 mmHg |
|---|
| Melting Point | 52-54°C |
|---|
| Molecular Formula | C5H3Cl2N3O2 |
|---|
| Molecular Weight | 208.002 |
|---|
| Flash Point | 142.4±26.5 °C |
|---|
| Exact Mass | 206.960236 |
|---|
| PSA | 71.60000 |
|---|
| LogP | 1.74 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | NBCOZXBHPKSFSA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1nc(Cl)nc(Cl)c1[N+](=O)[O-] |
|---|
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
|---|
| Stability | Moisture Sensitive |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-41 |
|---|
| Safety Phrases | 26-39 |
|---|
| HS Code | 2933599090 |
|---|
Customs
| HS Code | 2933599090 |
|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,6-dichloro-3-methyl-5-nitropyrimidine |
| 2,4-Dichloro-6-methyl-5-nitropyrimidine |
| MFCD00023196 |
| 5-nitro-6-methyl-2,4-dichloropyrimidine |
| Pyrimidine, 2,4-dichloro-6-methyl-5-nitro- |
| 2,4-Dichloro-5-nitro-6-methylpyrimidine |
| 2,4-dichloro-5-methyl-5-nitropyrimidine |
| 2,4,5-TRIBROMOIMIDAZOLE |
| 2,6-dichloro-4-methyl-5-nitropyrimidine |
| 2,4-dichlor-6-methyl-5-nitropyrimidin |
| 2,4-Dichloro-6-methyl-5-nitro pyrimidine |