Introduction：Basic information about CAS 134865-33-1|meluadrine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | meluadrine |
|---|
| CAS Number | 134865-33-1 | Molecular Weight | 243.73000 |
|---|
| Density | 1.184g/cm3 | Boiling Point | 392ºC at 760mmHg |
|---|
| Molecular Formula | C12H18ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 190.9ºC |
|---|
Names
| Name | 4-[(1R)-2-(tert-butylamino)-1-hydroxyethyl]-3-chlorophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.184g/cm3 |
|---|
| Boiling Point | 392ºC at 760mmHg |
|---|
| Molecular Formula | C12H18ClNO2 |
|---|
| Molecular Weight | 243.73000 |
|---|
| Flash Point | 190.9ºC |
|---|
| Exact Mass | 243.10300 |
|---|
| PSA | 52.49000 |
|---|
| LogP | 2.85800 |
|---|
| Vapour Pressure | 7.55E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | LIXBJWRFCNRAPA-NSHDSACASA-N |
|---|
| SMILES | CC(C)(C)NCC(O)c1ccc(O)cc1Cl |
|---|
Synonyms
| Meluadrine |
| Meluadrine [INN] |
