Introduction：Basic information about CAS 161225-76-9|1H-Pyrrolo[2,3-b]pyridine, 3-(phenylmethyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Pyrrolo[2,3-b]pyridine, 3-(phenylmethyl)- |
|---|
| CAS Number | 161225-76-9 | Molecular Weight | 208.25800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H12N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1H-Pyrrolo[2,3-b]pyridine, 3-(phenylmethyl) |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H12N2 |
|---|
| Molecular Weight | 208.25800 |
|---|
| Exact Mass | 208.10000 |
|---|
| PSA | 28.68000 |
|---|
| LogP | 3.15370 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | GZMFYYLEABBTHR-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(Cc2c[nH]c3ncccc23)cc1 |
|---|
