Introduction:Basic information about CAS 4433-78-7|Butanamide,N-[4-(acetylamino)phenyl]-3-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Butanamide,N-[4-(acetylamino)phenyl]-3-oxo- |
|---|
| CAS Number | 4433-78-7 | Molecular Weight | 234.25100 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 534.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H14N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 228ºC |
|---|
Names
| Name | N-(4-acetamidophenyl)-3-oxobutanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 534.4ºC at 760mmHg |
|---|
| Molecular Formula | C12H14N2O3 |
|---|
| Molecular Weight | 234.25100 |
|---|
| Flash Point | 228ºC |
|---|
| Exact Mass | 234.10000 |
|---|
| PSA | 75.27000 |
|---|
| LogP | 1.70860 |
|---|
| Index of Refraction | 1.606 |
|---|
| InChIKey | PNVSDRLLBNUJBE-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CC(=O)Nc1ccc(NC(C)=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-(Acetoacetylamino)acetanilide |
| Acetoacetanilide,4'-acetamido |
| p-Acetamidoacetoacetanilide |
| 4'-Acetamido-3-oxobutanilide |
| Butanamide,N-(4-(acetylamino)phenyl)-3-oxo |
| 1-Acetoacetylamino-4-acetylamino-benzol |
| N-[4-(acetylamino)phenyl]-3-oxobutyramide |
| N-Acetyl-N'-acetoacetyl-p-phenylendiamin |
| 1-acetoacetylamino-4-acetylamino-benzene |
| Acetessigsaeure-(4-acetamino-anilid) |
| 4'-Acetamidoacetoacetanilide |