Introduction：Basic information about CAS 3108-24-5|ethyl perfluorooctanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl perfluorooctanoate |
|---|
| CAS Number | 3108-24-5 | Molecular Weight | 442.12200 |
|---|
| Density | 1,626 g/cm3 | Boiling Point | 167 °C |
|---|
| Molecular Formula | C10H5F15O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167-168°C |
|---|
Names
| Name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,626 g/cm3 |
|---|
| Boiling Point | 167 °C |
|---|
| Molecular Formula | C10H5F15O2 |
|---|
| Molecular Weight | 442.12200 |
|---|
| Flash Point | 167-168°C |
|---|
| Exact Mass | 442.00500 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.92360 |
|---|
| Index of Refraction | 1.3118 |
|---|
| InChIKey | JTOFFHFAQBLPTM-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F: Flammable; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2915900090 |
|---|
Customs
| HS Code | 2915900090 |
|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| ethyl pentadecafluorooctanoate |
| Ethyl perfluorooctanonate |
| Ethyl F-octanoate |
| MFCD00018063 |
| pentadecafluoro-octanoic acid ethyl ester |
| ethyl F-heptanoate |
| Pentadecafluor-octansaeure-aethylester |
| Ethyl perfluorocaprylate |
| ETHYL PERFLUOROOCTANOATE |
| EINECS 221-468-4 |
