Introduction:Basic information about CAS 4445-59-4|1,1'-BIPHENYL]-3,5-DICARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1'-BIPHENYL]-3,5-DICARBOXYLIC ACID |
|---|
| CAS Number | 4445-59-4 | Molecular Weight | 274.22600 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H10O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 5-phenylbenzene-1,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H10O6 |
|---|
| Molecular Weight | 274.22600 |
|---|
| Exact Mass | 274.04800 |
|---|
| PSA | 93.06000 |
|---|
| LogP | 3.46720 |
|---|
| InChIKey | JJUJLQXTYRRNJE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2ccccc2)c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 5-Phenyl-isophthalsaeure |
| biphenyl-3,5-dicarboxylic acid |
| Isophthalic acid,5-phenyl |
| 5-Phenylisophthalic acid |
| Biphenyl-3,5-dicarbonsaeure |