Introduction：Basic information about CAS 61570-90-9|methyl N-(6-propoxy-1,3-benzothiazol-2-yl)carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl N-(6-propoxy-1,3-benzothiazol-2-yl)carbamate |
|---|
| CAS Number | 61570-90-9 | Molecular Weight | 266.31600 |
|---|
| Density | 1.313g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C12H14N2O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | methyl N-(6-propoxy-1,3-benzothiazol-2-yl)carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.313g/cm3 |
|---|
| Molecular Formula | C12H14N2O3S |
|---|
| Molecular Weight | 266.31600 |
|---|
| Exact Mass | 266.07300 |
|---|
| PSA | 88.69000 |
|---|
| LogP | 3.33640 |
|---|
| Index of Refraction | 1.634 |
|---|
| InChIKey | HLLICFJUWSZHRJ-UHFFFAOYSA-N |
|---|
| SMILES | CCCOc1ccc2nc(NC(=O)OC)sc2c1 |
|---|
Safety Information
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Tioxidazolum |
| (6-Propoxy-benzothiazol-2-yl)-carbamic acid methyl ester |
| methyl 6-propoxy-2-benzothiazolylcarbamate |
| Methyl-6-n-propoxybenzothiazol-2-carbamat |
| Tioxidazole |
| methyl-6-n-propoxybenzothiazole-2-carbamate |
| Tiox |
| methyl (6-propoxy-1,3-benzothiazol-2-yl)carbamate |
| Tioxidazol |
