Introduction：Basic information about CAS 1623-92-3|4-phenoxybenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-phenoxybenzenesulfonyl chloride |
|---|
| CAS Number | 1623-92-3 | Molecular Weight | 268.71600 |
|---|
| Density | 1.329g/cm3 | Boiling Point | 180°C 5mm |
|---|
| Molecular Formula | C12H9ClO3S | Melting Point | 43-44°C |
|---|
| MSDS | ChineseUSA | Flash Point | 180°C/5mm |
|---|
| Symbol |
GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-phenoxybenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.329g/cm3 |
|---|
| Boiling Point | 180°C 5mm |
|---|
| Melting Point | 43-44°C |
|---|
| Molecular Formula | C12H9ClO3S |
|---|
| Molecular Weight | 268.71600 |
|---|
| Flash Point | 180°C/5mm |
|---|
| Exact Mass | 267.99600 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 4.48720 |
|---|
| Vapour Pressure | 3.56E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | QIZPONOMFWAPRR-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(Oc2ccccc2)cc1 |
|---|
Safety Information
| Symbol |
GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| p-phenoxybenzensulfonyl chloride |
| 4-Phenoxybenzene-1-sulfonyl chloride |
| 4-Phenoxy-Benzenesulfonylchloride |
| 4-Phenoxybenzenesulfonyl chloride |
| MFCD00625748 |
| 4-phenoxyphenylsulfonyl chloride |
