Introduction:Basic information about CAS 137036-73-8|Stereoisomer of 3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(17),5,7,9(18),13,15-hexae, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Stereoisomer of 3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(17),5,7,9(18),13,15-hexaene-7,15-diamine |
|---|
| CAS Number | 137036-73-8 | Molecular Weight | 302.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C16H18N2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Stereoisomer of 3,11-dithiatricyclo[11.3.1.15,9]octadeca-1(17),5,7,9(18),13,15-hexaene-7,15-diamine |
|---|
Chemical & Physical Properties
| Molecular Formula | C16H18N2S2 |
|---|
| Molecular Weight | 302.5 |
|---|
| InChIKey | IKWMSDRRPPCQDJ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1cc2cc(c1)CSCc1cc(N)cc(c1)CSC2 |
|---|