Introduction：Basic information about CAS 1652-89-7|1,1,1-trifluoro-2,2,3,3,3-pentachloro-propane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1-trifluoro-2,2,3,3,3-pentachloro-propane |
|---|
| CAS Number | 1652-89-7 | Molecular Weight | 270.29200 |
|---|
| Density | 1.784g/cm3 | Boiling Point | 147.8ºC at 760mmHg |
|---|
| Molecular Formula | C3Cl5F3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 54.2ºC |
|---|
Names
| Name | 1,1,1-trifluoro-2,2,3,3,3-pentachloro-propane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.784g/cm3 |
|---|
| Boiling Point | 147.8ºC at 760mmHg |
|---|
| Molecular Formula | C3Cl5F3 |
|---|
| Molecular Weight | 270.29200 |
|---|
| Flash Point | 54.2ºC |
|---|
| Exact Mass | 267.83900 |
|---|
| LogP | 4.09280 |
|---|
| Vapour Pressure | 5.52mmHg at 25°C |
|---|
| Index of Refraction | 1.448 |
|---|
| InChIKey | GKXWTRSVUPXQMM-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(Cl)(Cl)C(Cl)(Cl)Cl |
|---|
Safety Information
Customs
| HS Code | 2903772022 |
|---|
| Summary | 2903772022 1,1,1,3,3-pentachloro-2,2,3-trifluoropropane。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。Lowest tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Propane,1,1,1,2,2-pentachloro-3,3,3-trifluoro |
| trifluoropentachloropropane |
| 2,2,3,3,3-Pentachloro-1,1,1-trifluoropropane |
| 1,1,1,2,2-Pentachlor-trifluor-propan |
| pentachloro-1,1,1-trifluoro-propane |
| Pentachlor-1,1,1-trifluor-propan |
| 1,1,1,2,2-pentachlorotrifluoropropane |
| 1,1,1,2,2-pentachloro-3,3,3-trifluoro-propane |
