Introduction:Basic information about CAS 16783-97-4|Rifamycin,25-O-deacetyl-3-formyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Rifamycin,25-O-deacetyl-3-formyl- |
|---|
| CAS Number | 16783-97-4 | Molecular Weight | 683.74200 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 861.6ºC at 760mmHg |
|---|
| Molecular Formula | C36H45NO12 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 474.9ºC |
|---|
Names
| Name | 3-Formyl-25-desacetyl Rifamycin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 861.6ºC at 760mmHg |
|---|
| Molecular Formula | C36H45NO12 |
|---|
| Molecular Weight | 683.74200 |
|---|
| Flash Point | 474.9ºC |
|---|
| Exact Mass | 683.29400 |
|---|
| PSA | 212.31000 |
|---|
| LogP | 4.13380 |
|---|
| Vapour Pressure | 1.18E-31mmHg at 25°C |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | GGZYOFVKHSKDIP-IPELWSGNSA-N |
|---|
| SMILES | COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(C=O)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(O)C1C |
|---|
Synonyms
| 25-O-Desacetyl-3-formyl-rifamycin SV |
| 3-ForMyl-25-desacetyl RifaMycin DISCONTINUED |
| 3-formyl-O25-deacetyl-rifamycin |
| 25-O-Deacetyl-3-formylrifamycin |
| (12S,3E,5S,13E,15Z)-15,6,9,7t,9c,11t-hexahydroxy-5r-methoxy-12,4,6t,8c,10c,12t,16-heptamethyl-11,17-dioxo-2-oxa-18-aza-1(2,7)-naphtho[2,1-b]furana-cyclooctadecaphane-3,13,15-triene-18-carbaldehyde |
| deacetylrifaldehyde |
| 1,2-Dihydro-5,6,9,17,19,21-hexahydroxy-23-methoxy-2,4,12,16,18,20,22-heptamethyl-1,11-dioxo-2,7-(epoxypentadeca[1,11,13]trienimino)naphtho[2,1-b]furan-8-carboxaldehyde |