Introduction：Basic information about CAS 13312-81-7|Benzeneacetonitrile, a-hydroxy-2-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetonitrile, a-hydroxy-2-nitro- |
|---|
| CAS Number | 13312-81-7 | Molecular Weight | 178.14500 |
|---|
| Density | 1.416g/cm3 | Boiling Point | 415.1ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.8ºC |
|---|
Names
| Name | 2-hydroxy-2-(2-nitrophenyl)acetonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.416g/cm3 |
|---|
| Boiling Point | 415.1ºC at 760mmHg |
|---|
| Molecular Formula | C8H6N2O3 |
|---|
| Molecular Weight | 178.14500 |
|---|
| Flash Point | 204.8ºC |
|---|
| Exact Mass | 178.03800 |
|---|
| PSA | 89.84000 |
|---|
| LogP | 1.67498 |
|---|
| Vapour Pressure | 1.24E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | YIBWLYSNBNNELO-UHFFFAOYSA-N |
|---|
| SMILES | N#CC(O)c1ccccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-(2-nitrophenyl)-2-hydroxyacetonitrile |
| o-nitromandelonitrile |
| 2-Nitromandelonitrile |
| 2-hydroxy-2-[2-nitrophenyl]acetonitrile |
| hydroxy{2-nitrophenyl}acetonitrile |
