Introduction：Basic information about CAS 367282-79-9|Benzyl 2-oxo-3-oxa-9-azaspiro[5.5]undecane-9-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzyl 2-oxo-3-oxa-9-azaspiro[5.5]undecane-9-carboxylate |
|---|
| CAS Number | 367282-79-9 | Molecular Weight | 303.35300 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 497.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzyl 2-oxo-3-oxa-9-azaspiro[5.5]undecane-9-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 497.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H21NO4 |
|---|
| Molecular Weight | 303.35300 |
|---|
| Exact Mass | 303.14700 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 2.68030 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | UJQQMJVKYHCRTP-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC2(CCO1)CCN(C(=O)OCc1ccccc1)CC2 |
|---|
